C17H14ClFN4O3 — CID 17437571
1-(2-chloro-5-nitrophenyl)-N-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylmethanamine (PubChem CID 17437571) has the molecular formula C17H14ClFN4O3 and a molecular weight of 376.78 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-N-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylmethanamine.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-N-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 17437571 |
| Molecular Formula | C17H14ClFN4O3 |
| Molecular Weight | 376.78 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-N-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylmethanamine |
| SMILES | CN(Cc1nc(-c2ccc(F)cc2)no1)Cc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H14ClFN4O3/c1-22(9-12-8-14(23(24)25)6-7-15(12)18)10-16-20-17(21-26-16)11-2-4-13(19)5-3-11/h2-8H,9-10H2,1H3 |
| InChIKey | MJHLXHHPAWZPPF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.78 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|