C15H9N3O4S — CID 71915245
3-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,3-benzothiazol-2-one (PubChem CID 71915245) has the molecular formula C15H9N3O4S and a molecular weight of 327.32 g/mol. Its IUPAC name is 3-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 71915245 |
| Molecular Formula | C15H9N3O4S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 3-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,3-benzothiazol-2-one |
| SMILES | O=c1sc2ccccc2n1Cc1nc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C15H9N3O4S/c19-15-17(11-3-1-2-4-13(11)23-15)8-14-16-10-7-9(18(20)21)5-6-12(10)22-14/h1-7H,8H2 |
| InChIKey | PMMQHUUOZFHYNI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|