C22H24N2O4 — CID 102505387
N-[(1S,4R,5S,6R)-5,6-dihydroxy-4-[(2-phenylacetyl)amino]cyclohex-2-en-1-yl]-2-phenylacetamide (PubChem CID 102505387) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[(1S,4R,5S,6R)-5,6-dihydroxy-4-[(2-phenylacetyl)amino]cyclohex-2-en-1-yl]-2-phenylacetamide.
| Compound Name | N-[(1S,4R,5S,6R)-5,6-dihydroxy-4-[(2-phenylacetyl)amino]cyclohex-2-en-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 102505387 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[(1S,4R,5S,6R)-5,6-dihydroxy-4-[(2-phenylacetyl)amino]cyclohex-2-en-1-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)N[C@H]1C=C[C@@H](NC(=O)Cc2ccccc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H24N2O4/c25-19(13-15-7-3-1-4-8-15)23-17-11-12-18(22(28)21(17)27)24-20(26)14-16-9-5-2-6-10-16/h1-12,17-18,21-22,27-28H,13-14H2,(H,23,25)(H,24,26)/t17-,18+,21+,22- |
| InChIKey | KAADISVBZGYWIN-MTIDIVMFSA-N |
| XLogP | 0.73 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|