C10H14O8S2 — CID 56839093
diethyl 1,1,4,4-tetraoxo-2,3-dihydro-1,4-dithiine-5,6-dicarboxylate (PubChem CID 56839093) has the molecular formula C10H14O8S2 and a molecular weight of 326.35 g/mol. Its IUPAC name is diethyl 1,1,4,4-tetraoxo-2,3-dihydro-1,4-dithiine-5,6-dicarboxylate.
| Compound Name | diethyl 1,1,4,4-tetraoxo-2,3-dihydro-1,4-dithiine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 56839093 |
| Molecular Formula | C10H14O8S2 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | diethyl 1,1,4,4-tetraoxo-2,3-dihydro-1,4-dithiine-5,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)S(=O)(=O)CCS1(=O)=O |
| InChI | InChI=1S/C10H14O8S2/c1-3-17-9(11)7-8(10(12)18-4-2)20(15,16)6-5-19(7,13)14/h3-6H2,1-2H3 |
| InChIKey | QULXYIHLUYMSCP-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |