C13H12O3 — CID 91476204
5-formyl-3-methyl-3,4-dihydronaphthalene-2-carboxylic acid (PubChem CID 91476204) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 5-formyl-3-methyl-3,4-dihydronaphthalene-2-carboxylic acid.
| Compound Name | 5-formyl-3-methyl-3,4-dihydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 91476204 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 5-formyl-3-methyl-3,4-dihydronaphthalene-2-carboxylic acid |
| SMILES | CC1Cc2c(C=O)cccc2C=C1C(=O)O |
| InChI | InChI=1S/C13H12O3/c1-8-5-12-9(6-11(8)13(15)16)3-2-4-10(12)7-14/h2-4,6-8H,5H2,1H3,(H,15,16) |
| InChIKey | AQEYJQUSTZUBNM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|