About 2-formylbenzoic acid;methoxymethane
2-formylbenzoic acid;methoxymethane (PubChem CID 90858085) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-formylbenzoic acid;methoxymethane.
Molecular Properties
| Compound Name | 2-formylbenzoic acid;methoxymethane |
| PubChem CID | 90858085 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-formylbenzoic acid;methoxymethane |
| SMILES | COC.COC.O=Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O3.2C2H6O/c9-5-6-3-1-2-4-7(6)8(10)11;2*1-3-2/h1-5H,(H,10,11);2*1-2H3 |
| InChIKey | AKGDGOTVUJZSJN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-formylbenzoic acid;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formylbenzoic acid;methoxymethane?
The IUPAC name of 2-formylbenzoic acid;methoxymethane (CID 90858085) is 2-formylbenzoic acid;methoxymethane.
What is the SMILES notation for 2-formylbenzoic acid;methoxymethane?
The canonical SMILES for 2-formylbenzoic acid;methoxymethane is COC.COC.O=Cc1ccccc1C(=O)O.
What is the InChIKey of 2-formylbenzoic acid;methoxymethane?
The InChIKey is AKGDGOTVUJZSJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O3.2C2H6O/c9-5-6-3-1-2-4-7(6)8(10)11;2*1-3-2/h1-5H,(H,10,11);2*1-2H3.
What are the key properties of 2-formylbenzoic acid;methoxymethane?
2-formylbenzoic acid;methoxymethane has a molecular weight of 242.27 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formylbenzoic acid;methoxymethane is sourced from PubChem (CID 90858085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).