About 3-formyl-2-iodobenzoic acid
3-formyl-2-iodobenzoic acid (PubChem CID 71422161) has the molecular formula C8H5IO3
and a molecular weight of 276.03 g/mol. Its IUPAC name is 3-formyl-2-iodobenzoic acid.
Molecular Properties
| Compound Name | 3-formyl-2-iodobenzoic acid |
| PubChem CID | 71422161 |
| Molecular Formula | C8H5IO3 |
| Molecular Weight | 276.03 g/mol |
| Exact Mass | 275.93 |
| IUPAC Name | 3-formyl-2-iodobenzoic acid |
| SMILES | O=Cc1cccc(C(=O)O)c1I |
| InChI | InChI=1S/C8H5IO3/c9-7-5(4-10)2-1-3-6(7)8(11)12/h1-4H,(H,11,12) |
| InChIKey | YISUSKYRZNWKLO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.03 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-formyl-2-iodobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formyl-2-iodobenzoic acid?
The IUPAC name of 3-formyl-2-iodobenzoic acid (CID 71422161) is 3-formyl-2-iodobenzoic acid.
What is the SMILES notation for 3-formyl-2-iodobenzoic acid?
The canonical SMILES for 3-formyl-2-iodobenzoic acid is O=Cc1cccc(C(=O)O)c1I.
What is the InChIKey of 3-formyl-2-iodobenzoic acid?
The InChIKey is YISUSKYRZNWKLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5IO3/c9-7-5(4-10)2-1-3-6(7)8(11)12/h1-4H,(H,11,12).
What are the key properties of 3-formyl-2-iodobenzoic acid?
3-formyl-2-iodobenzoic acid has a molecular weight of 276.03 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formyl-2-iodobenzoic acid is sourced from PubChem (CID 71422161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).