About 2,3-dibenzoylbenzaldehyde
2,3-dibenzoylbenzaldehyde (PubChem CID 54496315) has the molecular formula C21H14O3
and a molecular weight of 314.34 g/mol. Its IUPAC name is 2,3-dibenzoylbenzaldehyde.
Molecular Properties
| Compound Name | 2,3-dibenzoylbenzaldehyde |
| PubChem CID | 54496315 |
| Molecular Formula | C21H14O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2,3-dibenzoylbenzaldehyde |
| SMILES | O=Cc1cccc(C(=O)c2ccccc2)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H14O3/c22-14-17-12-7-13-18(20(23)15-8-3-1-4-9-15)19(17)21(24)16-10-5-2-6-11-16/h1-14H |
| InChIKey | BDLRXCYMTDUGNP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibenzoylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibenzoylbenzaldehyde?
The IUPAC name of 2,3-dibenzoylbenzaldehyde (CID 54496315) is 2,3-dibenzoylbenzaldehyde.
What is the SMILES notation for 2,3-dibenzoylbenzaldehyde?
The canonical SMILES for 2,3-dibenzoylbenzaldehyde is O=Cc1cccc(C(=O)c2ccccc2)c1C(=O)c1ccccc1.
What is the InChIKey of 2,3-dibenzoylbenzaldehyde?
The InChIKey is BDLRXCYMTDUGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14O3/c22-14-17-12-7-13-18(20(23)15-8-3-1-4-9-15)19(17)21(24)16-10-5-2-6-11-16/h1-14H.
What are the key properties of 2,3-dibenzoylbenzaldehyde?
2,3-dibenzoylbenzaldehyde has a molecular weight of 314.34 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibenzoylbenzaldehyde is sourced from PubChem (CID 54496315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).