C60H38O6 — CID 68746067
[2-benzoyl-3,4-bis(2,3-dibenzoylphenyl)phenyl]-phenylmethanone (PubChem CID 68746067) has the molecular formula C60H38O6 and a molecular weight of 854.96 g/mol. Its IUPAC name is [2-benzoyl-3,4-bis(2,3-dibenzoylphenyl)phenyl]-phenylmethanone.
| Compound Name | [2-benzoyl-3,4-bis(2,3-dibenzoylphenyl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 68746067 |
| Molecular Formula | C60H38O6 |
| Molecular Weight | 854.96 g/mol |
| Exact Mass | 854.27 |
| IUPAC Name | [2-benzoyl-3,4-bis(2,3-dibenzoylphenyl)phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cccc(-c2ccc(C(=O)c3ccccc3)c(C(=O)c3ccccc3)c2-c2cccc(C(=O)c3ccccc3)c2C(=O)c2ccccc2)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C60H38O6/c61-55(39-21-7-1-8-22-39)48-35-19-33-45(52(48)58(64)42-27-13-4-14-28-42)46-37-38-50(57(63)41-25-11-3-12-26-41)54(60(66)44-31-17-6-18-32-44)51(46)47-34-20-36-49(56(62)40-23-9-2-10-24-40)53(47)59(65)43-29-15-5-16-30-43/h1-38H |
| InChIKey | DHTSXJVVXVVLAO-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.96 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |