About 2-(1,2-diphenylethenyl)benzaldehyde
2-(1,2-diphenylethenyl)benzaldehyde (PubChem CID 87999369) has the molecular formula C21H16O
and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(1,2-diphenylethenyl)benzaldehyde.
Molecular Properties
| Compound Name | 2-(1,2-diphenylethenyl)benzaldehyde |
| PubChem CID | 87999369 |
| Molecular Formula | C21H16O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-(1,2-diphenylethenyl)benzaldehyde |
| SMILES | O=Cc1ccccc1C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16O/c22-16-19-13-7-8-14-20(19)21(18-11-5-2-6-12-18)15-17-9-3-1-4-10-17/h1-16H |
| InChIKey | PIFBXDGCEWCBDL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-diphenylethenyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-diphenylethenyl)benzaldehyde?
The IUPAC name of 2-(1,2-diphenylethenyl)benzaldehyde (CID 87999369) is 2-(1,2-diphenylethenyl)benzaldehyde.
What is the SMILES notation for 2-(1,2-diphenylethenyl)benzaldehyde?
The canonical SMILES for 2-(1,2-diphenylethenyl)benzaldehyde is O=Cc1ccccc1C(=Cc1ccccc1)c1ccccc1.
What is the InChIKey of 2-(1,2-diphenylethenyl)benzaldehyde?
The InChIKey is PIFBXDGCEWCBDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16O/c22-16-19-13-7-8-14-20(19)21(18-11-5-2-6-12-18)15-17-9-3-1-4-10-17/h1-16H.
What are the key properties of 2-(1,2-diphenylethenyl)benzaldehyde?
2-(1,2-diphenylethenyl)benzaldehyde has a molecular weight of 284.36 g/mol, XLogP of 5.09, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-diphenylethenyl)benzaldehyde is sourced from PubChem (CID 87999369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).