C23H23N — CID 102527150
2-[2-[(E)-1,2-diphenylethenyl]phenyl]propan-2-amine (PubChem CID 102527150) has the molecular formula C23H23N and a molecular weight of 313.44 g/mol. Its IUPAC name is 2-[2-[(E)-1,2-diphenylethenyl]phenyl]propan-2-amine.
| Compound Name | 2-[2-[(E)-1,2-diphenylethenyl]phenyl]propan-2-amine |
|---|---|
| PubChem CID | 102527150 |
| Molecular Formula | C23H23N |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-[2-[(E)-1,2-diphenylethenyl]phenyl]propan-2-amine |
| SMILES | CC(C)(N)c1ccccc1/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23N/c1-23(2,24)22-16-10-9-15-20(22)21(19-13-7-4-8-14-19)17-18-11-5-3-6-12-18/h3-17H,24H2,1-2H3/b21-17+ |
| InChIKey | WNJBUXBACPKEMP-HEHNFIMWSA-N |
| XLogP | 5.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|