C26H33BO5 — CID 175481277
boric acid;2,3-dimethylbutane-2,3-diol;1,2-diphenylethenylbenzene (PubChem CID 175481277) has the molecular formula C26H33BO5 and a molecular weight of 436.36 g/mol. Its IUPAC name is boric acid;2,3-dimethylbutane-2,3-diol;1,2-diphenylethenylbenzene.
| Compound Name | boric acid;2,3-dimethylbutane-2,3-diol;1,2-diphenylethenylbenzene |
|---|---|
| PubChem CID | 175481277 |
| Molecular Formula | C26H33BO5 |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | boric acid;2,3-dimethylbutane-2,3-diol;1,2-diphenylethenylbenzene |
| SMILES | C(=C(c1ccccc1)c1ccccc1)c1ccccc1.CC(C)(O)C(C)(C)O.OB(O)O |
| InChI | InChI=1S/C20H16.C6H14O2.BH3O3/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-5(2,7)6(3,4)8;2-1(3)4/h1-16H;7-8H,1-4H3;2-4H |
| InChIKey | RZKFANZOHGZYLA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|