C22H20 — CID 155936841
1-[(Z)-1,2-diphenylethenyl]-2,4-dimethylbenzene (PubChem CID 155936841) has the molecular formula C22H20 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-[(Z)-1,2-diphenylethenyl]-2,4-dimethylbenzene.
| Compound Name | 1-[(Z)-1,2-diphenylethenyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 155936841 |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-[(Z)-1,2-diphenylethenyl]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(/C(=C\c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H20/c1-17-13-14-21(18(2)15-17)22(20-11-7-4-8-12-20)16-19-9-5-3-6-10-19/h3-16H,1-2H3/b22-16- |
| InChIKey | MDLIGYPKJNFDOD-JWGURIENSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|