C30H29N — CID 20813136
N-[4-[(E)-2-(2,4-dimethylphenyl)-2-phenylethenyl]phenyl]-2,4-dimethylaniline (PubChem CID 20813136) has the molecular formula C30H29N and a molecular weight of 403.57 g/mol. Its IUPAC name is N-[4-[(E)-2-(2,4-dimethylphenyl)-2-phenylethenyl]phenyl]-2,4-dimethylaniline.
| Compound Name | N-[4-[(E)-2-(2,4-dimethylphenyl)-2-phenylethenyl]phenyl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 20813136 |
| Molecular Formula | C30H29N |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[4-[(E)-2-(2,4-dimethylphenyl)-2-phenylethenyl]phenyl]-2,4-dimethylaniline |
| SMILES | Cc1ccc(Nc2ccc(/C=C(\c3ccccc3)c3ccc(C)cc3C)cc2)c(C)c1 |
| InChI | InChI=1S/C30H29N/c1-21-10-16-28(23(3)18-21)29(26-8-6-5-7-9-26)20-25-12-14-27(15-13-25)31-30-17-11-22(2)19-24(30)4/h5-20,31H,1-4H3/b29-20+ |
| InChIKey | OKXNCQWGUPLWES-ZTKZIYFRSA-N |
| XLogP | 8.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|