C24H23NO — CID 71527195
2-[(E)-1,2-diphenylethenyl]-N,N,4-trimethylbenzamide (PubChem CID 71527195) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[(E)-1,2-diphenylethenyl]-N,N,4-trimethylbenzamide.
| Compound Name | 2-[(E)-1,2-diphenylethenyl]-N,N,4-trimethylbenzamide |
|---|---|
| PubChem CID | 71527195 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-[(E)-1,2-diphenylethenyl]-N,N,4-trimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)C)c(/C(=C/c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23NO/c1-18-14-15-21(24(26)25(2)3)23(16-18)22(20-12-8-5-9-13-20)17-19-10-6-4-7-11-19/h4-17H,1-3H3/b22-17+ |
| InChIKey | VXTIPRDPNKCWLB-OQKWZONESA-N |
| XLogP | 5.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|