C20H18O — CID 12624786
3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran (PubChem CID 12624786) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran.
| Compound Name | 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran |
|---|---|
| PubChem CID | 12624786 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran |
| SMILES | Cc1cc(/C(=C\c2ccccc2)c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C20H18O/c1-15-13-19(16(2)21-15)20(18-11-7-4-8-12-18)14-17-9-5-3-6-10-17/h3-14H,1-2H3/b20-14- |
| InChIKey | JQWAGPVANVQGRQ-ZHZULCJRSA-N |
| XLogP | 5.49 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|