About 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran
3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran (PubChem CID 12624786) has the molecular formula C20H18O
and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran.
Molecular Properties
| Compound Name | 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran |
| PubChem CID | 12624786 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran |
| SMILES | Cc1cc(/C(=C\c2ccccc2)c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C20H18O/c1-15-13-19(16(2)21-15)20(18-11-7-4-8-12-18)14-17-9-5-3-6-10-17/h3-14H,1-2H3/b20-14- |
| InChIKey | JQWAGPVANVQGRQ-ZHZULCJRSA-N |
| XLogP | 5.49 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran?
The IUPAC name of 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran (CID 12624786) is 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran.
What is the SMILES notation for 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran?
The canonical SMILES for 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran is Cc1cc(/C(=C\c2ccccc2)c2ccccc2)c(C)o1.
What is the InChIKey of 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran?
The InChIKey is JQWAGPVANVQGRQ-ZHZULCJRSA-N. The full InChI is InChI=1S/C20H18O/c1-15-13-19(16(2)21-15)20(18-11-7-4-8-12-18)14-17-9-5-3-6-10-17/h3-14H,1-2H3/b20-14-.
What are the key properties of 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran?
3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran has a molecular weight of 274.36 g/mol, XLogP of 5.49, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-1,2-diphenylethenyl]-2,5-dimethylfuran is sourced from PubChem (CID 12624786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).