C23H21NO — CID 121493703
3-[(E)-1,2-diphenylethenyl]-N,N-dimethylbenzamide (PubChem CID 121493703) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[(E)-1,2-diphenylethenyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[(E)-1,2-diphenylethenyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 121493703 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-[(E)-1,2-diphenylethenyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(/C(=C/c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21NO/c1-24(2)23(25)21-15-9-14-20(17-21)22(19-12-7-4-8-13-19)16-18-10-5-3-6-11-18/h3-17H,1-2H3/b22-16+ |
| InChIKey | UJXZVZJHBQORAD-CJLVFECKSA-N |
| XLogP | 4.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|