C22H18O — CID 121493701
1-[3-[(E)-1,2-diphenylethenyl]phenyl]ethanone (PubChem CID 121493701) has the molecular formula C22H18O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[3-[(E)-1,2-diphenylethenyl]phenyl]ethanone.
| Compound Name | 1-[3-[(E)-1,2-diphenylethenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 121493701 |
| Molecular Formula | C22H18O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[3-[(E)-1,2-diphenylethenyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(/C(=C/c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H18O/c1-17(23)20-13-8-14-21(16-20)22(19-11-6-3-7-12-19)15-18-9-4-2-5-10-18/h2-16H,1H3/b22-15+ |
| InChIKey | YFYIACVCQVPDAF-PXLXIMEGSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|