C23H20ClNO2 — CID 71615857
[5-chloro-2-[(E)-1,2-diphenylethenyl]phenyl] N,N-dimethylcarbamate (PubChem CID 71615857) has the molecular formula C23H20ClNO2 and a molecular weight of 377.87 g/mol. Its IUPAC name is [5-chloro-2-[(E)-1,2-diphenylethenyl]phenyl] N,N-dimethylcarbamate.
| Compound Name | [5-chloro-2-[(E)-1,2-diphenylethenyl]phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 71615857 |
| Molecular Formula | C23H20ClNO2 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | [5-chloro-2-[(E)-1,2-diphenylethenyl]phenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cc(Cl)ccc1/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20ClNO2/c1-25(2)23(26)27-22-16-19(24)13-14-20(22)21(18-11-7-4-8-12-18)15-17-9-5-3-6-10-17/h3-16H,1-2H3/b21-15+ |
| InChIKey | VXLCVBJTTCKHAK-RCCKNPSSSA-N |
| XLogP | 5.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|