C9H9BrClNO2 — CID 62706612
(2-bromo-5-chlorophenyl) N,N-dimethylcarbamate (PubChem CID 62706612) has the molecular formula C9H9BrClNO2 and a molecular weight of 278.53 g/mol. Its IUPAC name is (2-bromo-5-chlorophenyl) N,N-dimethylcarbamate.
| Compound Name | (2-bromo-5-chlorophenyl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 62706612 |
| Molecular Formula | C9H9BrClNO2 |
| Molecular Weight | 278.53 g/mol |
| Exact Mass | 276.95 |
| IUPAC Name | (2-bromo-5-chlorophenyl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C9H9BrClNO2/c1-12(2)9(13)14-8-5-6(11)3-4-7(8)10/h3-5H,1-2H3 |
| InChIKey | QDIWQNHVHADKQH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |