About (2-bromo-5-chlorophenyl) carbamate
(2-bromo-5-chlorophenyl) carbamate (PubChem CID 174508201) has the molecular formula C7H5BrClNO2
and a molecular weight of 250.48 g/mol. Its IUPAC name is (2-bromo-5-chlorophenyl) carbamate.
Molecular Properties
| Compound Name | (2-bromo-5-chlorophenyl) carbamate |
| PubChem CID | 174508201 |
| Molecular Formula | C7H5BrClNO2 |
| Molecular Weight | 250.48 g/mol |
| Exact Mass | 248.92 |
| IUPAC Name | (2-bromo-5-chlorophenyl) carbamate |
| SMILES | NC(=O)Oc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C7H5BrClNO2/c8-5-2-1-4(9)3-6(5)12-7(10)11/h1-3H,(H2,10,11) |
| InChIKey | GHJFZWZJIXYAHT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-bromo-5-chlorophenyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-5-chlorophenyl) carbamate?
The IUPAC name of (2-bromo-5-chlorophenyl) carbamate (CID 174508201) is (2-bromo-5-chlorophenyl) carbamate.
What is the SMILES notation for (2-bromo-5-chlorophenyl) carbamate?
The canonical SMILES for (2-bromo-5-chlorophenyl) carbamate is NC(=O)Oc1cc(Cl)ccc1Br.
What is the InChIKey of (2-bromo-5-chlorophenyl) carbamate?
The InChIKey is GHJFZWZJIXYAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrClNO2/c8-5-2-1-4(9)3-6(5)12-7(10)11/h1-3H,(H2,10,11).
What are the key properties of (2-bromo-5-chlorophenyl) carbamate?
(2-bromo-5-chlorophenyl) carbamate has a molecular weight of 250.48 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-5-chlorophenyl) carbamate is sourced from PubChem (CID 174508201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).