C31H37NO2 — CID 71615856
[2,4-ditert-butyl-6-[(E)-1,2-diphenylethenyl]phenyl] N,N-dimethylcarbamate (PubChem CID 71615856) has the molecular formula C31H37NO2 and a molecular weight of 455.64 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-[(E)-1,2-diphenylethenyl]phenyl] N,N-dimethylcarbamate.
| Compound Name | [2,4-ditert-butyl-6-[(E)-1,2-diphenylethenyl]phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 71615856 |
| Molecular Formula | C31H37NO2 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | [2,4-ditert-butyl-6-[(E)-1,2-diphenylethenyl]phenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1c(/C(=C/c2ccccc2)c2ccccc2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C31H37NO2/c1-30(2,3)24-20-26(28(34-29(33)32(7)8)27(21-24)31(4,5)6)25(23-17-13-10-14-18-23)19-22-15-11-9-12-16-22/h9-21H,1-8H3/b25-19+ |
| InChIKey | BQVFFYVLJQWZNV-NCELDCMTSA-N |
| XLogP | 7.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|