C20H12Cl3NO3 — CID 86575054
[5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] benzoate (PubChem CID 86575054) has the molecular formula C20H12Cl3NO3 and a molecular weight of 420.68 g/mol. Its IUPAC name is [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] benzoate.
| Compound Name | [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] benzoate |
|---|---|
| PubChem CID | 86575054 |
| Molecular Formula | C20H12Cl3NO3 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] benzoate |
| SMILES | O=C(Oc1cc(Cl)ccc1C(=O)Nc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C20H12Cl3NO3/c21-13-6-8-15(19(25)24-14-7-9-16(22)17(23)11-14)18(10-13)27-20(26)12-4-2-1-3-5-12/h1-11H,(H,24,25) |
| InChIKey | AZGYMUUOXLICMZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|