C31H31N — CID 58665589
N-[4-[2-(3,4-dimethylphenyl)-2-phenylethenyl]phenyl]-2,4,6-trimethylaniline (PubChem CID 58665589) has the molecular formula C31H31N and a molecular weight of 417.60 g/mol. Its IUPAC name is N-[4-[2-(3,4-dimethylphenyl)-2-phenylethenyl]phenyl]-2,4,6-trimethylaniline.
| Compound Name | N-[4-[2-(3,4-dimethylphenyl)-2-phenylethenyl]phenyl]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 58665589 |
| Molecular Formula | C31H31N |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | N-[4-[2-(3,4-dimethylphenyl)-2-phenylethenyl]phenyl]-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(Nc2ccc(C=C(c3ccccc3)c3ccc(C)c(C)c3)cc2)c(C)c1 |
| InChI | InChI=1S/C31H31N/c1-21-17-24(4)31(25(5)18-21)32-29-15-12-26(13-16-29)20-30(27-9-7-6-8-10-27)28-14-11-22(2)23(3)19-28/h6-20,32H,1-5H3 |
| InChIKey | ZZXBRKZFMPKWCN-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|