C34H37N — CID 122484933
N-[3-[4-[2-(3,4-dimethylphenyl)-2-(4-methylphenyl)ethenyl]phenyl]pentan-3-yl]aniline (PubChem CID 122484933) has the molecular formula C34H37N and a molecular weight of 459.68 g/mol. Its IUPAC name is N-[3-[4-[2-(3,4-dimethylphenyl)-2-(4-methylphenyl)ethenyl]phenyl]pentan-3-yl]aniline.
| Compound Name | N-[3-[4-[2-(3,4-dimethylphenyl)-2-(4-methylphenyl)ethenyl]phenyl]pentan-3-yl]aniline |
|---|---|
| PubChem CID | 122484933 |
| Molecular Formula | C34H37N |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | N-[3-[4-[2-(3,4-dimethylphenyl)-2-(4-methylphenyl)ethenyl]phenyl]pentan-3-yl]aniline |
| SMILES | CCC(CC)(Nc1ccccc1)c1ccc(C=C(c2ccc(C)cc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C34H37N/c1-6-34(7-2,35-32-11-9-8-10-12-32)31-21-16-28(17-22-31)24-33(29-18-13-25(3)14-19-29)30-20-15-26(4)27(5)23-30/h8-24,35H,6-7H2,1-5H3 |
| InChIKey | FWZQLRXRNDRALN-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|