C9H11BrO2 — CID 143221663
methyl 4-(bromomethyl)cyclohexa-1,3-diene-1-carboxylate (PubChem CID 143221663) has the molecular formula C9H11BrO2 and a molecular weight of 231.09 g/mol. Its IUPAC name is methyl 4-(bromomethyl)cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | methyl 4-(bromomethyl)cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 143221663 |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | methyl 4-(bromomethyl)cyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC=C(CBr)CC1 |
| InChI | InChI=1S/C9H11BrO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2,4H,3,5-6H2,1H3 |
| InChIKey | ZAUABEQYXKCVIJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|