About methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate
methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate (PubChem CID 139418915) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate.
Analyze methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate?
The IUPAC name of methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate (CID 139418915) is methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate.
What is the SMILES notation for methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate?
The canonical SMILES for methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate is COC(=O)C1=CN=C(CN)CC1.
What is the InChIKey of methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate?
The InChIKey is LIBACUKNXVCMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-12-8(11)6-2-3-7(4-9)10-5-6/h5H,2-4,9H2,1H3.
What are the key properties of methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate?
methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate has a molecular weight of 168.20 g/mol, XLogP of 0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(aminomethyl)-3,4-dihydropyridine-5-carboxylate is sourced from PubChem (CID 139418915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).