About methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate
methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate (PubChem CID 139930692) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate |
| PubChem CID | 139930692 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate |
| SMILES | COC(=O)C1=CN=C2C(=NC=N2)C1 |
| InChI | InChI=1S/C8H7N3O2/c1-13-8(12)5-2-6-7(9-3-5)11-4-10-6/h3-4H,2H2,1H3 |
| InChIKey | SEMNMPYPEZRUQX-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 63.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 377 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate?
The IUPAC name of methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate (CID 139930692) is methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate.
What is the SMILES notation for methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate?
The canonical SMILES for methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate is COC(=O)C1=CN=C2C(=NC=N2)C1.
What is the InChIKey of methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate?
The InChIKey is SEMNMPYPEZRUQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c1-13-8(12)5-2-6-7(9-3-5)11-4-10-6/h3-4H,2H2,1H3.
What are the key properties of methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate?
methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate has a molecular weight of 177.16 g/mol, XLogP of -0.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7H-imidazo[4,5-b]pyridine-6-carboxylate is sourced from PubChem (CID 139930692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).