About methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide
methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide (PubChem CID 173297533) has the molecular formula C7H11IN2O2
and a molecular weight of 282.08 g/mol. Its IUPAC name is methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide.
Molecular Properties
| Compound Name | methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide |
| PubChem CID | 173297533 |
| Molecular Formula | C7H11IN2O2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide |
| SMILES | COC(=O)C1=CN=CN(C)C1.I |
| InChI | InChI=1S/C7H10N2O2.HI/c1-9-4-6(3-8-5-9)7(10)11-2;/h3,5H,4H2,1-2H3;1H |
| InChIKey | ZYSRLEBHAYWJFD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide?
The IUPAC name of methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide (CID 173297533) is methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide.
What is the SMILES notation for methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide?
The canonical SMILES for methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide is COC(=O)C1=CN=CN(C)C1.I.
What is the InChIKey of methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide?
The InChIKey is ZYSRLEBHAYWJFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2.HI/c1-9-4-6(3-8-5-9)7(10)11-2;/h3,5H,4H2,1-2H3;1H.
What are the key properties of methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide?
methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide has a molecular weight of 282.08 g/mol, XLogP of 0.63, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-4H-pyrimidine-5-carboxylate;hydroiodide is sourced from PubChem (CID 173297533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).