C5H9N3O2 — CID 155668932
methyl 3-amino-1,2-dihydroimidazole-5-carboxylate (PubChem CID 155668932) has the molecular formula C5H9N3O2 and a molecular weight of 143.15 g/mol. Its IUPAC name is methyl 3-amino-1,2-dihydroimidazole-5-carboxylate.
| Compound Name | methyl 3-amino-1,2-dihydroimidazole-5-carboxylate |
|---|---|
| PubChem CID | 155668932 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | methyl 3-amino-1,2-dihydroimidazole-5-carboxylate |
| SMILES | COC(=O)C1=CN(N)CN1 |
| InChI | InChI=1S/C5H9N3O2/c1-10-5(9)4-2-8(6)3-7-4/h2,7H,3,6H2,1H3 |
| InChIKey | JYMQKCHPDJJYPA-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|