About methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride
methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride (PubChem CID 21241740) has the molecular formula C9H10ClNO2S
and a molecular weight of 231.70 g/mol. Its IUPAC name is methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride |
| PubChem CID | 21241740 |
| Molecular Formula | C9H10ClNO2S |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride |
| SMILES | COC(=O)C1=Cc2ccsc2CN1.Cl |
| InChI | InChI=1S/C9H9NO2S.ClH/c1-12-9(11)7-4-6-2-3-13-8(6)5-10-7;/h2-4,10H,5H2,1H3;1H |
| InChIKey | YDBOKNZMKXTSEZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride?
The IUPAC name of methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride (CID 21241740) is methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride.
What is the SMILES notation for methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride?
The canonical SMILES for methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride is COC(=O)C1=Cc2ccsc2CN1.Cl.
What is the InChIKey of methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride?
The InChIKey is YDBOKNZMKXTSEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S.ClH/c1-12-9(11)7-4-6-2-3-13-8(6)5-10-7;/h2-4,10H,5H2,1H3;1H.
What are the key properties of methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride?
methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride has a molecular weight of 231.70 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6,7-dihydrothieno[2,3-c]pyridine-5-carboxylate;hydrochloride is sourced from PubChem (CID 21241740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).