C9H12N2O3 — CID 166869376
methyl 5-(aminomethyl)-4-methoxypyridine-2-carboxylate (PubChem CID 166869376) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is methyl 5-(aminomethyl)-4-methoxypyridine-2-carboxylate.
| Compound Name | methyl 5-(aminomethyl)-4-methoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 166869376 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | methyl 5-(aminomethyl)-4-methoxypyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(OC)c(CN)cn1 |
| InChI | InChI=1S/C9H12N2O3/c1-13-8-3-7(9(12)14-2)11-5-6(8)4-10/h3,5H,4,10H2,1-2H3 |
| InChIKey | GYURWXQIQAIYOC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |