About ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate
ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate (PubChem CID 159885056) has the molecular formula C20H28N2O9
and a molecular weight of 440.45 g/mol. Its IUPAC name is ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate |
| PubChem CID | 159885056 |
| Molecular Formula | C20H28N2O9 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate |
| SMILES | CCO.CCOc1cnc(C(=O)OC)cc1OC.COC(=O)c1cc(OC)c(O)cn1 |
| InChI | InChI=1S/C10H13NO4.C8H9NO4.C2H6O/c1-4-15-9-6-11-7(10(12)14-3)5-8(9)13-2;1-12-7-3-5(8(11)13-2)9-4-6(7)10;1-2-3/h5-6H,4H2,1-3H3;3-4,10H,1-2H3;3H,2H2,1H3 |
| InChIKey | NUAJEYAQCKEKKL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate?
The IUPAC name of ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate (CID 159885056) is ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate.
What is the SMILES notation for ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate?
The canonical SMILES for ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate is CCO.CCOc1cnc(C(=O)OC)cc1OC.COC(=O)c1cc(OC)c(O)cn1.
What is the InChIKey of ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate?
The InChIKey is NUAJEYAQCKEKKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4.C8H9NO4.C2H6O/c1-4-15-9-6-11-7(10(12)14-3)5-8(9)13-2;1-12-7-3-5(8(11)13-2)9-4-6(7)10;1-2-3/h5-6H,4H2,1-3H3;3-4,10H,1-2H3;3H,2H2,1H3.
What are the key properties of ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate?
ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate has a molecular weight of 440.45 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;methyl 5-ethoxy-4-methoxypyridine-2-carboxylate;methyl 5-hydroxy-4-methoxypyridine-2-carboxylate is sourced from PubChem (CID 159885056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).