About 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide
5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide (PubChem CID 155071926) has the molecular formula C9H13N3O3
and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide.
Molecular Properties
| Compound Name | 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide |
| PubChem CID | 155071926 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide |
| SMILES | CCOc1cnc(C(N)=NO)cc1OC |
| InChI | InChI=1S/C9H13N3O3/c1-3-15-8-5-11-6(9(10)12-13)4-7(8)14-2/h4-5,13H,3H2,1-2H3,(H2,10,12) |
| InChIKey | LEXIXJJUIZSEPK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide?
The IUPAC name of 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide (CID 155071926) is 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide.
What is the SMILES notation for 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide?
The canonical SMILES for 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide is CCOc1cnc(C(N)=NO)cc1OC.
What is the InChIKey of 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide?
The InChIKey is LEXIXJJUIZSEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3/c1-3-15-8-5-11-6(9(10)12-13)4-7(8)14-2/h4-5,13H,3H2,1-2H3,(H2,10,12).
What are the key properties of 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide?
5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide has a molecular weight of 211.22 g/mol, XLogP of 0.58, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-N'-hydroxy-4-methoxypyridine-2-carboximidamide is sourced from PubChem (CID 155071926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).