C14H15N3O4 — CID 136990840
5-(3,5-dimethoxyphenoxy)-N'-hydroxypyridine-2-carboximidamide (PubChem CID 136990840) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenoxy)-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 5-(3,5-dimethoxyphenoxy)-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136990840 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5-(3,5-dimethoxyphenoxy)-N'-hydroxypyridine-2-carboximidamide |
| SMILES | COc1cc(OC)cc(Oc2ccc(/C(N)=N/O)nc2)c1 |
| InChI | InChI=1S/C14H15N3O4/c1-19-10-5-11(20-2)7-12(6-10)21-9-3-4-13(16-8-9)14(15)17-18/h3-8,18H,1-2H3,(H2,15,17) |
| InChIKey | BNUYRBKSIJQNPD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|