C8H11N3O2 — CID 123379844
N',5-dimethoxypyridine-2-carboximidamide (PubChem CID 123379844) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is N',5-dimethoxypyridine-2-carboximidamide.
| Compound Name | N',5-dimethoxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 123379844 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N',5-dimethoxypyridine-2-carboximidamide |
| SMILES | CON=C(N)c1ccc(OC)cn1 |
| InChI | InChI=1S/C8H11N3O2/c1-12-6-3-4-7(10-5-6)8(9)11-13-2/h3-5H,1-2H3,(H2,9,11) |
| InChIKey | KXXGCDXKSRPNGD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|