C18H23BrNO2+ — CID 91596681
methyl 8-bromo-1-phenyl-1-propyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate (PubChem CID 91596681) has the molecular formula C18H23BrNO2+ and a molecular weight of 365.29 g/mol. Its IUPAC name is methyl 8-bromo-1-phenyl-1-propyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate.
| Compound Name | methyl 8-bromo-1-phenyl-1-propyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 91596681 |
| Molecular Formula | C18H23BrNO2+ |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | methyl 8-bromo-1-phenyl-1-propyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate |
| SMILES | CCC[N+]1(c2ccccc2)CCCC(C(=O)OC)=CC=C1Br |
| InChI | InChI=1S/C18H23BrNO2/c1-3-13-20(16-9-5-4-6-10-16)14-7-8-15(18(21)22-2)11-12-17(20)19/h4-6,9-12H,3,7-8,13-14H2,1-2H3/q+1 |
| InChIKey | UUBXNEAYWPPHRI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|