C34H40NO4+ — CID 91020411
methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-phenyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate (PubChem CID 91020411) has the molecular formula C34H40NO4+ and a molecular weight of 526.70 g/mol. Its IUPAC name is methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-phenyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate.
| Compound Name | methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-phenyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 91020411 |
| Molecular Formula | C34H40NO4+ |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-phenyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate |
| SMILES | CCCCOCCOc1ccc(C2=CC=C(C(=O)OC)CCC[N+]2(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H40NO4/c1-3-4-24-38-25-26-39-32-20-17-29(18-21-32)33-22-19-30(34(36)37-2)14-11-23-35(33,31-15-9-6-10-16-31)27-28-12-7-5-8-13-28/h5-10,12-13,15-22H,3-4,11,14,23-27H2,1-2H3/q+1 |
| InChIKey | OBOZRWCPDIGUOB-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|