C30H41NO4 — CID 68649754
methyl (6Z)-9-[4-(2-butoxyethoxy)phenyl]-1-(2-methylpropyl)-2,3,4,5-tetrahydro-1-benzazonine-6-carboxylate (PubChem CID 68649754) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is methyl (6Z)-9-[4-(2-butoxyethoxy)phenyl]-1-(2-methylpropyl)-2,3,4,5-tetrahydro-1-benzazonine-6-carboxylate.
| Compound Name | methyl (6Z)-9-[4-(2-butoxyethoxy)phenyl]-1-(2-methylpropyl)-2,3,4,5-tetrahydro-1-benzazonine-6-carboxylate |
|---|---|
| PubChem CID | 68649754 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | methyl (6Z)-9-[4-(2-butoxyethoxy)phenyl]-1-(2-methylpropyl)-2,3,4,5-tetrahydro-1-benzazonine-6-carboxylate |
| SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)/C=C(\C(=O)OC)CCCCN3CC(C)C)cc1 |
| InChI | InChI=1S/C30H41NO4/c1-5-6-17-34-18-19-35-28-13-10-24(11-14-28)25-12-15-29-27(20-25)21-26(30(32)33-4)9-7-8-16-31(29)22-23(2)3/h10-15,20-21,23H,5-9,16-19,22H2,1-4H3/b26-21- |
| InChIKey | VIOYWUHLRGWDII-QLYXXIJNSA-N |
| XLogP | 6.75 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|