C31H35NO5 — CID 22329110
methyl 7-[4-(2-butoxyethoxy)phenyl]-1-(3-methoxyphenyl)-2,3-dihydro-1-benzazepine-4-carboxylate (PubChem CID 22329110) has the molecular formula C31H35NO5 and a molecular weight of 501.62 g/mol. Its IUPAC name is methyl 7-[4-(2-butoxyethoxy)phenyl]-1-(3-methoxyphenyl)-2,3-dihydro-1-benzazepine-4-carboxylate.
| Compound Name | methyl 7-[4-(2-butoxyethoxy)phenyl]-1-(3-methoxyphenyl)-2,3-dihydro-1-benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 22329110 |
| Molecular Formula | C31H35NO5 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | methyl 7-[4-(2-butoxyethoxy)phenyl]-1-(3-methoxyphenyl)-2,3-dihydro-1-benzazepine-4-carboxylate |
| SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)C=C(C(=O)OC)CCN3c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C31H35NO5/c1-4-5-17-36-18-19-37-28-12-9-23(10-13-28)24-11-14-30-26(20-24)21-25(31(33)35-3)15-16-32(30)27-7-6-8-29(22-27)34-2/h6-14,20-22H,4-5,15-19H2,1-3H3 |
| InChIKey | WRGVGLIJSXLFLH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|