C29H37NO4 — CID 74016541
methyl 5-[4-(2-butoxyethoxy)phenyl]-1-azatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,8-tetraene-9-carboxylate (PubChem CID 74016541) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is methyl 5-[4-(2-butoxyethoxy)phenyl]-1-azatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,8-tetraene-9-carboxylate.
| Compound Name | methyl 5-[4-(2-butoxyethoxy)phenyl]-1-azatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,8-tetraene-9-carboxylate |
|---|---|
| PubChem CID | 74016541 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | methyl 5-[4-(2-butoxyethoxy)phenyl]-1-azatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,8-tetraene-9-carboxylate |
| SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)C=C(C(=O)OC)CCC2CCCCN32)cc1 |
| InChI | InChI=1S/C29H37NO4/c1-3-4-17-33-18-19-34-27-13-9-22(10-14-27)23-11-15-28-25(20-23)21-24(29(31)32-2)8-12-26-7-5-6-16-30(26)28/h9-11,13-15,20-21,26H,3-8,12,16-19H2,1-2H3 |
| InChIKey | YBAVBXRUPKCCEW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|