C39H47N5O4S — CID 87915569
(9E)-13-[4-(2-butoxyethoxy)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]-2,15-diazatricyclo[9.4.0.02,6]pentadeca-1(11),9,12,14-tetraene-9-carboxamide (PubChem CID 87915569) has the molecular formula C39H47N5O4S and a molecular weight of 681.90 g/mol. Its IUPAC name is (9E)-13-[4-(2-butoxyethoxy)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]-2,15-diazatricyclo[9.4.0.02,6]pentadeca-1(11),9,12,14-tetraene-9-carboxamide.
| Compound Name | (9E)-13-[4-(2-butoxyethoxy)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]-2,15-diazatricyclo[9.4.0.02,6]pentadeca-1(11),9,12,14-tetraene-9-carboxamide |
|---|---|
| PubChem CID | 87915569 |
| Molecular Formula | C39H47N5O4S |
| Molecular Weight | 681.90 g/mol |
| Exact Mass | 681.33 |
| IUPAC Name | (9E)-13-[4-(2-butoxyethoxy)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]-2,15-diazatricyclo[9.4.0.02,6]pentadeca-1(11),9,12,14-tetraene-9-carboxamide |
| SMILES | CCCCOCCOc1ccc(-c2cnc3c(c2)/C=C(/C(=O)Nc2ccc([S@@](=O)Cc4cncn4CCC)cc2)CCC2CCCN32)cc1 |
| InChI | InChI=1S/C39H47N5O4S/c1-3-5-20-47-21-22-48-36-14-9-29(10-15-36)32-24-31-23-30(8-13-34-7-6-19-44(34)38(31)41-25-32)39(45)42-33-11-16-37(17-12-33)49(46)27-35-26-40-28-43(35)18-4-2/h9-12,14-17,23-26,28,34H,3-8,13,18-22,27H2,1-2H3,(H,42,45)/b30-23+/t34?,49-/m0/s1 |
| InChIKey | OKBVPRKZMYBGMV-HSKONAFFSA-N |
| XLogP | 7.64 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.90 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|