C34H38ClN3O4S — CID 146247070
(E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-chlorophenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide (PubChem CID 146247070) has the molecular formula C34H38ClN3O4S and a molecular weight of 620.22 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-chlorophenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-chlorophenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146247070 |
| Molecular Formula | C34H38ClN3O4S |
| Molecular Weight | 620.22 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-chlorophenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
| SMILES | CCCCOCCOc1ccc(-c2ccc(Cl)c(/C=C/C(=O)Nc3ccc([S@@](=O)Cc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C34H38ClN3O4S/c1-3-5-19-41-20-21-42-31-12-6-26(7-13-31)27-8-16-33(35)28(22-27)9-17-34(39)37-29-10-14-32(15-11-29)43(40)24-30-23-36-25-38(30)18-4-2/h6-17,22-23,25H,3-5,18-21,24H2,1-2H3,(H,37,39)/b17-9+/t43-/m0/s1 |
| InChIKey | XUHJRJQXBKZXHF-UJTUURRASA-N |
| XLogP | 7.77 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.22 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|