C32H34ClN3O3S — CID 142370001
(E)-3-[5-(4-butoxyphenyl)-2-chlorophenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide (PubChem CID 142370001) has the molecular formula C32H34ClN3O3S and a molecular weight of 576.16 g/mol. Its IUPAC name is (E)-3-[5-(4-butoxyphenyl)-2-chlorophenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(4-butoxyphenyl)-2-chlorophenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 142370001 |
| Molecular Formula | C32H34ClN3O3S |
| Molecular Weight | 576.16 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | (E)-3-[5-(4-butoxyphenyl)-2-chlorophenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
| SMILES | CCCCOc1ccc(-c2ccc(Cl)c(/C=C/C(=O)Nc3ccc(S(=O)Cc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C32H34ClN3O3S/c1-3-5-19-39-29-12-6-24(7-13-29)25-8-16-31(33)26(20-25)9-17-32(37)35-27-10-14-30(15-11-27)40(38)22-28-21-34-23-36(28)18-4-2/h6-17,20-21,23H,3-5,18-19,22H2,1-2H3,(H,35,37)/b17-9+ |
| InChIKey | BHVVBYVINFHJPL-RQZCQDPDSA-N |
| XLogP | 7.75 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.16 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|