C32H32ClFN2O3S — CID 158230733
(E)-4-[2-chloro-5-[4-(3-fluoropropoxy)phenyl]phenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 158230733) has the molecular formula C32H32ClFN2O3S and a molecular weight of 579.14 g/mol. Its IUPAC name is (E)-4-[2-chloro-5-[4-(3-fluoropropoxy)phenyl]phenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[2-chloro-5-[4-(3-fluoropropoxy)phenyl]phenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158230733 |
| Molecular Formula | C32H32ClFN2O3S |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | (E)-4-[2-chloro-5-[4-(3-fluoropropoxy)phenyl]phenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCn1cncc1CS(=O)c1ccc(CC(=O)/C=C/c2cc(-c3ccc(OCCCF)cc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C32H32ClFN2O3S/c1-2-17-36-23-35-21-28(36)22-40(38)31-13-4-24(5-14-31)19-29(37)10-6-27-20-26(9-15-32(27)33)25-7-11-30(12-8-25)39-18-3-16-34/h4-15,20-21,23H,2-3,16-19,22H2,1H3/b10-6+ |
| InChIKey | TUYKTBDPQBYIKV-UXBLZVDNSA-N |
| XLogP | 7.48 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|