C37H44N2O5S — CID 158231220
(E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-ethoxyphenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 158231220) has the molecular formula C37H44N2O5S and a molecular weight of 628.84 g/mol. Its IUPAC name is (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-ethoxyphenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-ethoxyphenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158231220 |
| Molecular Formula | C37H44N2O5S |
| Molecular Weight | 628.84 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-ethoxyphenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOCCOc1ccc(-c2ccc(OCC)c(/C=C/C(=O)Cc3ccc(S(=O)Cc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C37H44N2O5S/c1-4-7-21-42-22-23-44-35-15-11-30(12-16-35)31-13-19-37(43-6-3)32(25-31)10-14-34(40)24-29-8-17-36(18-9-29)45(41)27-33-26-38-28-39(33)20-5-2/h8-19,25-26,28H,4-7,20-24,27H2,1-3H3/b14-10+ |
| InChIKey | NZHYSGACLYCBMF-GXDHUFHOSA-N |
| XLogP | 7.69 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.84 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|