C33H35ClN2O3S — CID 157244365
(E)-4-[5-(4-butoxyphenyl)-2-chlorophenyl]-1-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 157244365) has the molecular formula C33H35ClN2O3S and a molecular weight of 575.17 g/mol. Its IUPAC name is (E)-4-[5-(4-butoxyphenyl)-2-chlorophenyl]-1-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-(4-butoxyphenyl)-2-chlorophenyl]-1-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157244365 |
| Molecular Formula | C33H35ClN2O3S |
| Molecular Weight | 575.17 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | (E)-4-[5-(4-butoxyphenyl)-2-chlorophenyl]-1-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOc1ccc(-c2ccc(Cl)c(/C=C/C(=O)Cc3ccc([S@](=O)Cc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C33H35ClN2O3S/c1-3-5-19-39-31-13-9-26(10-14-31)27-11-17-33(34)28(21-27)8-12-30(37)20-25-6-15-32(16-7-25)40(38)23-29-22-35-24-36(29)18-4-2/h6-17,21-22,24H,3-5,18-20,23H2,1-2H3/b12-8+/t40-/m1/s1 |
| InChIKey | FUCWWTJDHQRXFE-BWVQTOBSSA-N |
| XLogP | 7.93 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.17 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|