C33H36ClN3O3S — CID 146247018
(E)-3-[5-(4-butoxyphenyl)-2-chlorophenyl]-N-[4-[(R)-(3-butylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide (PubChem CID 146247018) has the molecular formula C33H36ClN3O3S and a molecular weight of 590.19 g/mol. Its IUPAC name is (E)-3-[5-(4-butoxyphenyl)-2-chlorophenyl]-N-[4-[(R)-(3-butylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(4-butoxyphenyl)-2-chlorophenyl]-N-[4-[(R)-(3-butylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146247018 |
| Molecular Formula | C33H36ClN3O3S |
| Molecular Weight | 590.19 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | (E)-3-[5-(4-butoxyphenyl)-2-chlorophenyl]-N-[4-[(R)-(3-butylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
| SMILES | CCCCOc1ccc(-c2ccc(Cl)c(/C=C/C(=O)Nc3ccc([S@](=O)Cc4cncn4CCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C33H36ClN3O3S/c1-3-5-19-37-24-35-22-29(37)23-41(39)31-15-11-28(12-16-31)36-33(38)18-10-27-21-26(9-17-32(27)34)25-7-13-30(14-8-25)40-20-6-4-2/h7-18,21-22,24H,3-6,19-20,23H2,1-2H3,(H,36,38)/b18-10+/t41-/m1/s1 |
| InChIKey | ODCKDZFHIZCXRA-QVLNRSSASA-N |
| XLogP | 8.14 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.19 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|