C36H41ClN2O5S — CID 158512755
(E)-4-[5-[4-(2-butoxyethoxy)phenyl]-3-chloro-2-methoxyphenyl]-1-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 158512755) has the molecular formula C36H41ClN2O5S and a molecular weight of 649.25 g/mol. Its IUPAC name is (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-3-chloro-2-methoxyphenyl]-1-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-3-chloro-2-methoxyphenyl]-1-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158512755 |
| Molecular Formula | C36H41ClN2O5S |
| Molecular Weight | 649.25 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-3-chloro-2-methoxyphenyl]-1-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOCCOc1ccc(-c2cc(Cl)c(OC)c(/C=C/C(=O)Cc3ccc([S@](=O)Cc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C36H41ClN2O5S/c1-4-6-18-43-19-20-44-33-13-10-28(11-14-33)30-22-29(36(42-3)35(37)23-30)9-12-32(40)21-27-7-15-34(16-8-27)45(41)25-31-24-38-26-39(31)17-5-2/h7-16,22-24,26H,4-6,17-21,25H2,1-3H3/b12-9+/t45-/m1/s1 |
| InChIKey | VBINFCGKMAXZFI-GHUYEULASA-N |
| XLogP | 7.95 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.25 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|