C38H46N2O4S — CID 159463260
(E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylphenyl]-1-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 159463260) has the molecular formula C38H46N2O4S and a molecular weight of 626.86 g/mol. Its IUPAC name is (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylphenyl]-1-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylphenyl]-1-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 159463260 |
| Molecular Formula | C38H46N2O4S |
| Molecular Weight | 626.86 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylphenyl]-1-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOCCOc1ccc(-c2ccc(C(C)C)c(/C=C/C(=O)Cc3ccc([S@@](=O)Cc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C38H46N2O4S/c1-5-7-21-43-22-23-44-36-15-11-31(12-16-36)32-13-19-38(29(3)4)33(25-32)10-14-35(41)24-30-8-17-37(18-9-30)45(42)27-34-26-39-28-40(34)20-6-2/h8-19,25-26,28-29H,5-7,20-24,27H2,1-4H3/b14-10+/t45-/m0/s1 |
| InChIKey | UTGGAVYKCXHWGM-GYLIAKLUSA-N |
| XLogP | 8.41 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.86 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|